CymitQuimica logo

CAS 1000342-15-3

:

4-Fluoro-3-iodo-7-methoxy-1H-indazole

Description:
4-Fluoro-3-iodo-7-methoxy-1H-indazole is a chemical compound characterized by its unique indazole structure, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of a fluorine atom at the 4-position and an iodine atom at the 3-position introduces significant electronegative characteristics, influencing the compound's reactivity and potential biological activity. The methoxy group at the 7-position enhances its solubility and may affect its interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of oncology and neurology, where indazole derivatives have shown promise. Its molecular properties, such as melting point, solubility, and spectral characteristics, can vary based on the specific conditions and solvents used. As with many halogenated compounds, it is essential to handle 4-Fluoro-3-iodo-7-methoxy-1H-indazole with care due to potential toxicity and environmental impact.
Formula:C8H6FIN2O
InChI:InChI=1S/C8H6FIN2O/c1-13-5-3-2-4(9)6-7(5)11-12-8(6)10/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=WFMGJARLIRXNNU-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(F)C=C1)C(I)=NN2
Synonyms:
  • 1H-Indazole, 4-fluoro-3-iodo-7-methoxy-
  • 4-Fluoro-3-iodo-7-methoxy-1H-indazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.