CAS 1006348-92-0
:Ethyl 5-(methoxycarbonyl)-1H-pyrazole-1-acetate
Description:
Ethyl 5-(methoxycarbonyl)-1H-pyrazole-1-acetate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethyl ester functional group and a methoxycarbonyl substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the methoxycarbonyl group enhances its solubility in organic solvents, making it useful in various chemical reactions. Ethyl 5-(methoxycarbonyl)-1H-pyrazole-1-acetate is often studied for its biological activities, including potential anti-inflammatory and analgesic properties. Its molecular structure allows for various modifications, which can lead to the development of derivatives with enhanced pharmacological effects. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in both synthetic and medicinal chemistry. Overall, this compound exemplifies the diverse functionalities of pyrazole derivatives in chemical research and applications.
Formula:C9H12N2O4
InChI:InChI=1S/C9H12N2O4/c1-3-15-8(12)6-11-7(4-5-10-11)9(13)14-2/h4-5H,3,6H2,1-2H3
InChI key:InChIKey=NDUKCFDUVAAYLX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N(CC(OCC)=O)N=CC1
Synonyms:- Ethyl 5-(methoxycarbonyl)-1H-pyrazole-1-acetate
- 1H-Pyrazole-1-acetic acid, 5-(methoxycarbonyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.