CymitQuimica logo

CAS 1009013-42-6

:

Vardenafil Impurity 15

Description:
Vardenafil Impurity 15, with the CAS number 1009013-42-6, is a chemical compound associated with the pharmaceutical drug vardenafil, which is primarily used to treat erectile dysfunction. As an impurity, it may arise during the synthesis or degradation of vardenafil and is typically characterized by its molecular structure, which may include specific functional groups that differentiate it from the parent compound. Impurities like Vardenafil Impurity 15 are important in pharmaceutical development and quality control, as they can affect the efficacy and safety of the final drug product. The characterization of such impurities often involves techniques like chromatography and mass spectrometry to determine their identity and concentration. Regulatory agencies require thorough analysis of impurities to ensure that they are within acceptable limits to maintain drug quality. Understanding the properties and behavior of impurities is crucial for pharmaceutical formulation and stability studies.
Formula:C19H25N5O4S
InChI:InChI=1S/C19H25N5O4S/c1-6-8-16-20-12(3)17-19(25)21-18(22-24(16)17)14-11-13(29(26,27)23(4)5)9-10-15(14)28-7-2/h9-11H,6-8H2,1-5H3,(H,21,22,25)
InChI key:XIIARACBUVESKP-UHFFFAOYSA-N
SMILES:CCCC1=NC(=C2N1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N(C)C)OCC)C
Synonyms:
  • VardefilImpurity15
  • Vardena hydrochloride impurity F
Found 2 products.