CAS 101080-38-0
:(2E)-N-(2-BROMOPHENYL)-2-(HYDROXYIMINO)ACETAMIDE
Description:
(2E)-N-(2-Bromophenyl)-2-(hydroxyimino)acetamide is a chemical compound characterized by its unique structural features, including a bromophenyl group and a hydroxyimino functional group. This compound typically exhibits properties associated with both amides and oximes, which can influence its reactivity and solubility. The presence of the bromine atom may impart specific electronic effects, potentially enhancing its reactivity in nucleophilic substitution reactions. The hydroxyimino group contributes to the compound's ability to participate in various chemical transformations, including condensation and cyclization reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in fields such as agrochemicals or pharmaceuticals, where derivatives of amides and oximes are often explored for their therapeutic properties. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility would need to be determined experimentally for precise characterization.
Formula:C8H7BrN2O2
InChI:InChI=1/C8H7BrN2O2/c9-6-3-1-2-4-7(6)11-8(12)5-10-13/h1-5,13H,(H,11,12)/b10-5-
SMILES:c1ccc(c(c1)Br)N=C(/C=N\O)O
Synonyms:- (2Z)-N-(2-bromophenyl)-2-(hydroxyimino)ethanamide
- N-(2-Bromophenyl)-2-(hydroxyimino)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
