CAS 1011397-72-0
:1-(4-Fluorophenyl)-6-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
Description:
1-(4-Fluorophenyl)-6-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. The presence of a fluorophenyl group enhances its potential for biological activity, while the carboxylic acid functional group contributes to its acidity and solubility in polar solvents. This compound is typically studied for its pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the pyrazolo-pyridine framework can lead to compounds with varying biological activities. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery. The compound's stability, reactivity, and solubility can be influenced by the substituents on the rings, particularly the fluorine atom, which can affect electronic properties and steric hindrance. Overall, this compound represents a class of molecules that may exhibit significant therapeutic potential, warranting further investigation in both synthetic and biological contexts.
Formula:C14H10FN3O2
InChI:InChI=1S/C14H10FN3O2/c1-8-6-11(14(19)20)12-7-16-18(13(12)17-8)10-4-2-9(15)3-5-10/h2-7H,1H3,(H,19,20)
InChI key:InChIKey=QRBYDCCQGOKGCE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(N(N=C2)C3=CC=C(F)C=C3)=NC(C)=C1
Synonyms:- 1-(4-Fluorophenyl)-6-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
- 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-(4-fluorophenyl)-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.