CAS 110193-49-2

(R)-5-(3-Hydroxyphenyl)-3-methyl-2-oxazolidinone

Description:

(R)-5-(3-Hydroxyphenyl)-3-methyl-2-oxazolidinone, with the CAS number 110193-49-2, is a chiral compound belonging to the oxazolidinone class, which is characterized by a five-membered heterocyclic ring containing one nitrogen and one oxygen atom. This compound features a hydroxyl group attached to a phenyl ring, contributing to its potential biological activity and solubility properties. The presence of the methyl group and the specific stereochemistry indicated by the (R) configuration suggests that it may exhibit distinct pharmacological effects, making it of interest in medicinal chemistry. Oxazolidinones are known for their antibacterial properties, and this particular compound may also be investigated for its role in various therapeutic applications. Its molecular structure allows for interactions with biological targets, potentially influencing its efficacy and safety profile. As with many chiral compounds, the stereochemistry can significantly affect the compound's behavior in biological systems, including its metabolism and interaction with enzymes or receptors.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1/C10H11NO3/c1-11-6-9(14-10(11)13)7-3-2-4-8(12)5-7/h2-5,9,12H,6H2,1H3/t9-/m0/s1

SMILES: CN1C[C@@H](c2cccc(c2)O)OC1=O

Synonyms:

• (R)-3-[5-(N-Methyl-2-oxozolidonyl)]phenol