CAS 110231-33-9
:Fumifungin
Description:
Fumifungin is a chemical compound classified as a secondary metabolite produced by certain fungi, particularly from the genus *Fusarium*. It is known for its antifungal properties and has been studied for its potential therapeutic applications. The compound exhibits a complex structure, featuring multiple functional groups that contribute to its biological activity. Fumifungin acts primarily by inhibiting the growth of various fungal pathogens, making it of interest in the field of medicinal chemistry and pharmacology. Its mechanism of action involves interference with fungal cell wall synthesis, which is crucial for maintaining cell integrity. Additionally, Fumifungin has shown promise in research related to immunosuppressive effects, although its clinical use is limited. The compound is typically characterized by its solubility in organic solvents and its stability under specific conditions. As with many bioactive compounds, further studies are necessary to fully understand its pharmacokinetics, toxicity, and potential applications in treating fungal infections or other diseases.
Formula:C22H41NO7
InChI:InChI=1S/C22H41NO7/c1-3-4-5-10-13-17(25)14-11-8-6-7-9-12-15-18(26)21(30-16(2)24)20(27)19(23)22(28)29/h12,15,17-21,25-27H,3-11,13-14,23H2,1-2H3,(H,28,29)
InChI key:InChIKey=OOEOVXMORBPOKC-UHFFFAOYSA-N
SMILES:C(C(C(C(O)=O)N)O)(C(C=CCCCCCCC(CCCCCC)O)O)OC(C)=O
Synonyms:- Fumifungin
- (6E)-4-(acetyloxy)-2-amino-3,5,14-trihydroxyicos-6-enoic acid
- (6E)-4-(Acetyloxy)-2-amino-3,5,14-trihydroxy-6-eicosenoic acid
- 6-Eicosenoic acid, 4-(acetyloxy)-2-amino-3,5,14-trihydroxy-
- 6-Eicosenoic acid, 4-(acetyloxy)-2-amino-3,5,14-trihydroxy-, (6E)-
- 2-Amino-4-acetoxy-3,5,14-trihydroxyeicosenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fumifungin
CAS:<p>Fumifungin is a useful organic compound for research related to life sciences. The catalog number is T126406 and the CAS number is 110231-33-9.</p>Formula:C22H41NO7Color and Shape:SolidMolecular weight:431.57
