CymitQuimica logo

CAS 1107603-45-1

:

4'-(trifluoroMethyl)biphenyl-3-ylboronic acid

Description:
4'-(Trifluoromethyl)biphenyl-3-ylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a biphenyl structure, specifically at the 3-position of one of the phenyl rings. The trifluoromethyl group at the 4' position significantly influences its electronic properties, making it a valuable compound in organic synthesis and medicinal chemistry. This compound is typically used in Suzuki-Miyaura cross-coupling reactions, which are essential for forming carbon-carbon bonds in the synthesis of complex organic molecules. The presence of the boronic acid group allows for the formation of stable complexes with various substrates, enhancing its utility in various applications, including drug development and materials science. Additionally, the trifluoromethyl group can impart unique solubility and reactivity characteristics, making this compound of interest in the design of new pharmaceuticals and agrochemicals. Its stability and reactivity under various conditions further contribute to its significance in synthetic organic chemistry.
Formula:C13H10BF3O2
InChI:InChI=1S/C13H10BF3O2/c15-13(16,17)11-6-4-9(5-7-11)10-2-1-3-12(8-10)14(18)19/h1-8,18-19H
InChI key:BHAAKODXXMTNDE-UHFFFAOYSA-N
SMILES:B(C1=CC(=CC=C1)C2=CC=C(C=C2)C(F)(F)F)(O)O
Synonyms:
  • 4'-(trifluoroMethyl)biphenyl-3-ylboronic acid
  • Boronic acid, B-[4'-(trifluoromethyl)[1,1'-biphenyl]-3-yl]-
  • 3-[4-(trifluoromethyl)phenyl]phenylboronic acid
  • (4'-(Trifluoromethyl)-[1,1'-biphenyl]-3-yl)boronic acid
  • (4-(TRIFLUOROMETHYL)-[1,1-BIPHENYL]-3-YL)BORONIC ACID
Found 1 products.