CymitQuimica logo

CAS 1108712-51-1

:

5-Methyl-4-pyridazinecarboxylic acid

Description:
5-Methyl-4-pyridazinecarboxylic acid is an organic compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) and a methyl group (-CH3) attached to the pyridazine ring, influencing its chemical reactivity and solubility. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound may exhibit acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of the methyl group can affect the compound's biological activity and interaction with other molecules. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled.
Formula:C6H6N2O2
InChI:InChI=1S/C6H6N2O2/c1-4-2-7-8-3-5(4)6(9)10/h2-3H,1H3,(H,9,10)
InChI key:InChIKey=JGJUEUVYZDSDES-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C)=CN=NC1
Synonyms:
  • 4-Pyridazinecarboxylic acid,5-methyl
  • 5-Methyl-Pyridazine-4-Carboxylic Acid
  • 5-Methyl-4-Pyridazinecarboxylic Acid
Found 3 products.