CAS 1127-60-2

2,4-Dichloro-3-ethyl-5-methylphenol

Description:

2,4-Dichloro-3-ethyl-5-methylphenol, with the CAS number 1127-60-2, is an organic compound that belongs to the class of chlorinated phenols. It is characterized by the presence of two chlorine atoms and a phenolic hydroxyl group, which contribute to its chemical reactivity and potential applications. This compound typically appears as a solid or crystalline substance and is known for its antimicrobial properties, making it useful in various industrial applications, including as a preservative and disinfectant. Its structure includes an ethyl group and a methyl group attached to the aromatic ring, influencing its solubility and interaction with other substances. The presence of chlorine atoms enhances its stability and resistance to degradation. However, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and regulation. Overall, 2,4-Dichloro-3-ethyl-5-methylphenol is significant in both industrial chemistry and environmental science due to its functional properties and potential impacts.

Formula: C₉H₁₀Cl₂O

InChI: InChI=1S/C9H10Cl2O/c1-3-6-8(10)5(2)4-7(12)9(6)11/h4,12H,3H2,1-2H3

InChI key: InChIKey=NOEYLPXWMIBMCJ-UHFFFAOYSA-N

SMILES: C(C)C1=C(Cl)C(C)=CC(O)=C1Cl

Synonyms:

• 3-Ethyl-2,4-dichloro-5-methyl-phenol
• NSC 63357
• Phenol, 2,4-Dichloro-3-Ethyl-5-Methyl-
• m-Cresol, 4,6-dichloro-5-ethyl-
• 2,4-Dichloro-3-ethyl-5-methylphenol