CAS 1156542-28-7: 5-Chloro-4-(trifluoromethyl)-2-pyridinecarbonitrile

Description:5-Chloro-4-(trifluoromethyl)-2-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 5-position and a trifluoromethyl group at the 4-position significantly influences its chemical properties, including its reactivity and polarity. The cyano group (-C≡N) at the 2-position contributes to its overall functionality, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. Its trifluoromethyl group enhances lipophilicity, which can affect its biological activity and interaction with various targets. Additionally, the presence of halogens and the cyano group can impart unique electronic properties, making it a subject of interest in medicinal chemistry and materials science. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula:C₇H₂ClF₃N₂

InChI:InChI=1S/C7H2ClF3N2/c8-6-3-13-4(2-12)1-5(6)7(9,10)11/h1,3H

InChI key:InChIKey=SPNZMEZMUQOGRF-UHFFFAOYSA-N

SMILES:N#CC1=NC=C(Cl)C(=C1)C(F)(F)F

Synonyms:
5-Chloro-4-(trifluoromethyl)-2-pyridinecarbonitrile
2-Pyridinecarbonitrile, 5-chloro-4-(trifluoromethyl)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
5-Chloro-4-(trifluoromethyl)picolinonitrile REF: IN-DA01KL4OCAS: 1156542-28-7	95%	To inquire	Tue 01 Apr 25
5-Chloro-4-(trifluoromethyl)picolinonitrile REF: 10-F545946CAS: 1156542-28-7	95.0%	83.00 €~1,252.00 €	Wed 02 Apr 25
5-Chloro-4-(trifluoromethyl)picolinonitrile REF: 3D-GWB54228CAS: 1156542-28-7	Min. 95%	- - -	Discontinued product