CAS 1158680-98-8: 1-(Tetrahydro-2H-pyran-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole

Description: 1-(Tetrahydro-2H-pyran-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, with CAS number 1158680-98-8, is a chemical compound characterized by its complex structure, which includes an indazole core and a tetrahydropyran moiety. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The compound's molecular framework indicates it may exhibit unique reactivity due to the electron-rich indazole and the boron-containing group, which can participate in various chemical transformations. Additionally, the tetrahydropyran ring contributes to the compound's three-dimensional shape, potentially influencing its biological activity and solubility. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature typically require careful handling due to their potential reactivity and the presence of boron, which can form complexes with various substrates. Overall, this compound represents a valuable structure in medicinal chemistry and synthetic organic chemistry.

Formula: C₁₈H₂₅BN₂O₃

InChI: InChI=1S/C18H25BN2O3/c1-17(2)18(3,4)24-19(23-17)14-9-8-13-12-20-21(15(13)11-14)16-7-5-6-10-22-16/h8-9,11-12,16H,5-7,10H2,1-4H3

InChI key: InChIKey=SXVSMJSODQLQDT-UHFFFAOYSA-N

SMILES: N1=CC=2C=CC(=CC2N1C3OCCCC3)B4OC(C)(C)C(O4)(C)C

1-(Tetrahydro-2H-pyran-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole

CAS: 1158680-98-8

• Purity: 98+%
• Molecular weight: 328.2200012207031

1-(tetrahydro-2H-pyran)-1H-indazol-6-boronic acid pinacol ester

CAS: 1158680-98-8

• Formula: C₁₈H₂₅BN₂O₃
• Purity: 98%
• Molecular weight: 328.2137

1-Tetrahydropyran-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole

CAS: 1158680-98-8

Versatile small molecule scaffold

• Formula: C₁₈H₂₅BN₂O₃
• Purity: Min. 95%
• Molecular weight: 328.2 g/mol