CAS 1158755-27-1: 7-Ethenylisoquinoline

Description:7-Ethenylisoquinoline is an organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of an ethenyl group (vinyl group) at the 7-position of the isoquinoline framework contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a pale yellow to brown liquid or solid, depending on its purity and specific conditions. It is known for its aromatic properties, which can influence its behavior in chemical reactions, particularly in electrophilic substitution and polymerization processes. The compound may exhibit biological activity, making it of interest in pharmacological research. Its CAS number, 1158755-27-1, allows for precise identification in chemical databases. As with many organic compounds, handling precautions should be observed due to potential toxicity or reactivity. Overall, 7-Ethenylisoquinoline represents a unique structure that may serve as a building block in the development of more complex molecules in various fields of chemistry.

Formula:C₁₁H₉N

InChI:InChI=1S/C11H9N/c1-2-9-3-4-10-5-6-12-8-11(10)7-9/h2-8H,1H2

InChI key:InChIKey=LELPWQUXFMMEKH-UHFFFAOYSA-N

SMILES:N=1C=CC=2C=CC(C=C)=CC2C1