CAS 1159511-78-0: 4-Bromo-1,6-dimethyl-1H-indazole

Description:4-Bromo-1,6-dimethyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 4-position and two methyl groups at the 1 and 6 positions contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, the methyl groups can influence the compound's steric and electronic properties, potentially affecting its biological activity. 4-Bromo-1,6-dimethyl-1H-indazole may be of interest in medicinal chemistry and research due to its structural features, which could lead to the development of novel pharmaceuticals or agrochemicals. As with many indazole derivatives, it may also exhibit interesting pharmacological properties, warranting further investigation.

Formula:C₉H₉BrN₂

InChI:InChI=1S/C9H9BrN2/c1-6-3-8(10)7-5-11-12(2)9(7)4-6/h3-5H,1-2H3

InChI key:InChIKey=IRRYVOVYPSBYMW-UHFFFAOYSA-N

SMILES:BrC1=CC(=CC2=C1C=NN2C)C

Synonyms:
1H-Indazole, 4-bromo-1,6-dimethyl-
4-Bromo-1,6-dimethyl-1H-indazole

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1H-Indazole, 4-bromo-1,6-dimethyl- REF: IN-DA01OVEJCAS: 1159511-78-0	97%	132.00 €~897.00 €	Fri 04 Apr 25
4-Bromo-1,6-dimethyl-1H-indazole REF: 54-OR40125CAS: 1159511-78-0	- - -	To inquire	Mon 07 Apr 25
4-Bromo-1,6-dimethyl-1H-indazole REF: 10-F630750CAS: 1159511-78-0	98%	- - -	Discontinued product
4-Bromo-1,6-dimethyl-1H-indazole REF: 3D-JWB51178CAS: 1159511-78-0	Min. 95%	- - -	Discontinued product