CAS 1159814-05-7: 4-Bromo-2-(1-pyrrolidinyl)pyrimidine

Description: 4-Bromo-2-(1-pyrrolidinyl)pyrimidine is a heterocyclic organic compound characterized by the presence of a pyrimidine ring substituted with a bromine atom and a pyrrolidine moiety. The bromine substitution typically enhances the compound's reactivity, making it useful in various synthetic applications. The pyrrolidine group contributes to the compound's basicity and potential interactions with biological targets, which may be relevant in medicinal chemistry. This compound may exhibit properties such as solubility in polar organic solvents, and its structure suggests potential applications in drug development, particularly in the design of pharmaceuticals targeting specific biological pathways. Additionally, the presence of both the bromine atom and the nitrogen-containing pyrrolidine ring may influence the compound's electronic properties, stability, and interaction with other molecules. Overall, 4-Bromo-2-(1-pyrrolidinyl)pyrimidine is of interest in research fields that explore the synthesis of novel compounds and their biological activities.

Formula: C₈H₁₀BrN₃

InChI: InChI=1S/C8H10BrN3/c9-7-3-4-10-8(11-7)12-5-1-2-6-12/h3-4H,1-2,5-6H2

InChI key: InChIKey=XINLHXGETKGJNE-UHFFFAOYSA-N

SMILES: BrC1=NC(=NC=C1)N2CCCC2

Synonyms:

• 4-Bromo-2-(1-pyrrolidinyl)pyrimidine
• Pyrimidine, 4-bromo-2-(1-pyrrolidinyl)-

4-Bromo-2-(pyrrolidin-1-yl)pyrimidine

CAS: 1159814-05-7

Versatile small molecule scaffold

• Formula: C₈H₁₀BrN₃
• Purity: Min. 95%
• Molecular weight: 228.09 g/mol