CAS 1159815-92-5: 2-(3-Furanyl)-6-methyl-4-pyrimidinamine

Description:2-(3-Furanyl)-6-methyl-4-pyrimidinamine is an organic compound characterized by its unique structure, which includes a pyrimidine ring substituted with a furanyl group and a methyl group. The presence of the furanyl moiety contributes to its aromatic properties, while the pyrimidine ring is known for its role in various biological activities. This compound may exhibit potential pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests that it could participate in hydrogen bonding and other interactions due to the presence of nitrogen and oxygen atoms. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, 2-(3-Furanyl)-6-methyl-4-pyrimidinamine represents a class of compounds that may have applications in drug development and other fields of chemical research.

Formula:C₉H₉N₃O

InChI:InChI=1S/C9H9N3O/c1-6-4-8(10)12-9(11-6)7-2-3-13-5-7/h2-5H,1H3,(H2,10,11,12)

InChI key:InChIKey=YYOZXYIKVVBCGJ-UHFFFAOYSA-N

SMILES:N1=C(N=C(C=C1N)C)C2=COC=C2