CAS 1159816-47-3: 2-Cyclobutyl-5-thiazolamine

Description: 2-Cyclobutyl-5-thiazolamine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of the cyclobutyl group contributes to its unique structural properties, influencing its reactivity and potential applications. This compound typically exhibits characteristics such as moderate solubility in organic solvents, and its functional groups may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The thiazole moiety is known for its biological activity, making compounds like 2-Cyclobutyl-5-thiazolamine of interest in medicinal chemistry for potential pharmaceutical applications. Additionally, the compound's stability and reactivity can be affected by the steric and electronic effects of the cyclobutyl group. Overall, 2-Cyclobutyl-5-thiazolamine represents a class of compounds that may have significant implications in drug development and other chemical applications, although specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.

Formula: C₇H₁₀N₂S

InChI: InChI=1S/C7H10N2S/c8-6-4-9-7(10-6)5-2-1-3-5/h4-5H,1-3,8H2

InChI key: InChIKey=MIVUDSOGXVCGEV-UHFFFAOYSA-N

SMILES: N=1C=C(SC1C2CCC2)N

Synonyms:

• 2-Cyclobutyl-5-thiazolamine
• 5-Thiazolamine, 2-cyclobutyl-

2-Cyclobutylthiazol-5-amine

CAS: 1159816-47-3

Versatile small molecule scaffold

• Formula: C₇H₁₀N₂S
• Purity: Min. 95%
• Molecular weight: 154.24 g/mol