CAS 1159829-79-4: 1H-Pyrazolo[4,3-c]pyridine-4-carbonitrile

Description:1H-Pyrazolo[4,3-c]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine rings. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the carbonitrile group can enhance its ability to participate in nucleophilic reactions, making it a valuable intermediate in organic synthesis. Additionally, compounds of this class may exhibit biological activity, which has led to interest in their potential as pharmaceuticals or agrochemicals. The molecular structure allows for various substitution patterns, which can influence its chemical properties and biological interactions. Overall, 1H-Pyrazolo[4,3-c]pyridine-4-carbonitrile is a compound of interest in both synthetic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula:C₇H₄N₄

InChI:InChI=1S/C7H4N4/c8-3-7-5-4-10-11-6(5)1-2-9-7/h1-2,4H,(H,10,11)

InChI key:InChIKey=RSELTZYUSOHTLH-UHFFFAOYSA-N

SMILES:N#CC1=NC=CC=2NN=CC12