CAS 1159981-99-3: 2-(Bromomethyl)pyrazolo[1,5-a]pyrimidine

Description:2-(Bromomethyl)pyrazolo[1,5-a]pyrimidine is a heterocyclic organic compound characterized by the presence of both a pyrazole and a pyrimidine ring, which contributes to its unique chemical properties. The bromomethyl group attached to the pyrazolo ring enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound typically exhibits moderate to high solubility in polar organic solvents, which is influenced by the presence of the bromine atom and the nitrogen atoms in the rings. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit various functional properties, such as fluorescence or specific reactivity patterns, depending on the substituents and the overall molecular environment. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-(Bromomethyl)pyrazolo[1,5-a]pyrimidine is a versatile compound with significant implications in synthetic and medicinal chemistry.

Formula:C₇H₆BrN₃

InChI:InChI=1S/C7H6BrN3/c8-5-6-4-7-9-2-1-3-11(7)10-6/h1-4H,5H2

InChI key:InChIKey=JEPJJBNYVQKKRX-UHFFFAOYSA-N

SMILES:BrCC1=NN2C=CC=NC2=C1