CAS 1160246-25-2: 5-Methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description: 5-Methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a methyl group at the 5-position of the pyrazole ring and an acetic acid functional group, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, which may include anti-inflammatory or analgesic effects. Its unique structure allows for interactions with various biological targets, making it a candidate for further research in drug development. As with many heterocycles, the stability and reactivity of 5-Methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid can be influenced by the presence of substituents and the overall electronic environment of the molecule.

Formula: C₉H₉N₃O₂

InChI: InChI=1S/C9H9N3O2/c1-6-2-7-4-11-12(5-8(13)14)9(7)10-3-6/h2-4H,5H2,1H3,(H,13,14)

InChI key: InChIKey=KICZOAAIQKXMFG-UHFFFAOYSA-N

SMILES: O=C(O)CN1N=CC=2C=C(C=NC21)C

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 5-methyl-
• 5-Methyl-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

2-{5-Methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}acetic acid

CAS: 1160246-25-2

Versatile small molecule scaffold

• Formula: C₉H₉N₃O₂
• Purity: Min. 95%
• Molecular weight: 191.19 g/mol

(5-methyl-1H-pyrazolo[3,4-b]pyridin-1-yl)acetic acid

CAS: 1160246-25-2

• Molecular weight: 191.19000244140625