CAS 1160246-26-3: 5-Methyl-2H-pyrazolo[3,4-b]pyridine-2-acetic acid

Description: 5-Methyl-2H-pyrazolo[3,4-b]pyridine-2-acetic acid is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which features a fused ring system containing both pyrazole and pyridine moieties. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating both nitrogen and carbon atoms, along with a carboxylic acid functional group. The presence of the methyl group at the 5-position contributes to its unique chemical properties, potentially influencing its reactivity and solubility. As a derivative of pyrazolo-pyridine, it may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications can vary, but compounds in this class are often investigated for their potential as pharmaceuticals, particularly in the context of neurological or inflammatory conditions. The compound's CAS number, 1160246-26-3, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields.

Formula: C₉H₉N₃O₂

InChI: InChI=1S/C9H9N3O2/c1-6-2-7-4-12(5-8(13)14)11-9(7)10-3-6/h2-4H,5H2,1H3,(H,13,14)

InChI key: InChIKey=FGORNRHVYWLLJE-UHFFFAOYSA-N

SMILES: O=C(O)CN1N=C2N=CC(=CC2=C1)C

Synonyms:

• 5-Methyl-2H-pyrazolo[3,4-b]pyridine-2-acetic acid
• 2H-Pyrazolo[3,4-b]pyridine-2-acetic acid, 5-methyl-

2-{5-Methyl-2H-pyrazolo[3,4-b]pyridin-2-yl}acetic acid

CAS: 1160246-26-3

Versatile small molecule scaffold

• Formula: C₉H₉N₃O₂
• Purity: Min. 95%
• Molecular weight: 191.19 g/mol

(5-methyl-2H-pyrazolo[3,4-b]pyridin-2-yl)acetic acid

CAS: 1160246-26-3

• Molecular weight: 191.19000244140625