CAS 1160254-41-0: 2-(3-Methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description: 2-(3-Methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline core substituted with a methoxyphenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoline derivatives are known for their diverse biological activities, including antimalarial and anticancer properties. Additionally, the presence of the carbonyl chloride functional group may facilitate further chemical modifications, making it a versatile intermediate in organic synthesis. As with many chemical substances, safety precautions should be observed when handling this compound due to its reactive nature.

Formula: C₁₈H₁₄ClNO₂

InChI: InChI=1S/C18H14ClNO2/c1-11-5-3-8-14-15(18(19)21)10-16(20-17(11)14)12-6-4-7-13(9-12)22-2/h3-10H,1-2H3

InChI key: InChIKey=KFXSOTGDPVOMDG-UHFFFAOYSA-N

SMILES: O=C(Cl)C=1C=C(N=C2C1C=CC=C2C)C=3C=CC=C(OC)C3

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(3-methoxyphenyl)-8-methyl-
• 2-(3-Methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride

2-(3-methoxyphenyl)-8-methylquinoline-4-carbonyl chloride

CAS: 1160254-41-0

• Molecular weight: 311.7699890136719

2-(3-Methoxyphenyl)-8-methylquinoline-4-carbonyl chloride

CAS: 1160254-41-0

Please enquire for more information about 2-(3-Methoxyphenyl)-8-methylquinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₁₈H₁₄ClNO₂
• Purity: Min. 95%
• Molecular weight: 311.76 g/mol