CAS 1160573-88-5: 2-Bromo-3,5-dichloro-4-fluoro-1-iodobenzene
Description:2-Bromo-3,5-dichloro-4-fluoro-1-iodobenzene is a halogenated aromatic compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features bromine, chlorine, fluorine, and iodine atoms, which significantly influence its chemical properties and reactivity. The presence of these halogens can enhance the compound's lipophilicity and alter its electronic characteristics, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound's structure suggests it may exhibit interesting biological activity due to the diverse halogen substituents, which can affect interactions with biological targets. Additionally, the presence of multiple halogens can lead to increased stability and resistance to degradation. However, the specific reactivity and applications would depend on the context of its use, including the conditions under which it is synthesized or applied. Safety considerations are also paramount, as halogenated compounds can pose environmental and health risks. Overall, 2-Bromo-3,5-dichloro-4-fluoro-1-iodobenzene is a complex molecule with significant potential in various fields of chemistry.
Formula:C6HBrCl2FI
InChI:InChI=1S/C6HBrCl2FI/c7-4-3(11)1-2(8)6(10)5(4)9/h1H
InChI key:InChIKey=JJZULRZPQWTRMG-UHFFFAOYSA-N
SMILES:FC1=C(Cl)C=C(I)C(Br)=C1Cl
- Synonyms:
- 2-Bromo-3,5-dichloro-4-fluoro-1-iodobenzene
- Benzene, 2-bromo-3,5-dichloro-4-fluoro-1-iodo-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Bromo-3,5-dichloro-4-fluoroiodobenzene REF: 10-F037467CAS: 1160573-88-5 | 98% | 486.00 €~1,338.00 € | Wed 26 Mar 25 |
![]() | 2-Bromo-3,5-dichloro-4-fluoroiodobenzene REF: 3D-KWB57388CAS: 1160573-88-5 | Min. 95% | - - - | Discontinued product |

2-Bromo-3,5-dichloro-4-fluoroiodobenzene
Ref: 10-F037467
1g | 486.00 € | ||
5g | 1,338.00 € |

2-Bromo-3,5-dichloro-4-fluoroiodobenzene
Ref: 3D-KWB57388
5g | Discontinued | Request information | |
10g | Discontinued | Request information |