CAS 116122-36-2: Breviscapine
Description:Breviscapine is a chemical compound derived from the traditional Chinese medicinal herb Erigeron breviscapus, commonly used for its potential therapeutic effects. It is primarily known for its active components, which include flavonoids that exhibit antioxidant, anti-inflammatory, and neuroprotective properties. Breviscapine is often studied for its potential benefits in improving microcirculation, enhancing cognitive function, and providing protective effects against ischemic damage. The compound is typically characterized by its ability to modulate various biochemical pathways, including those involved in vascular health and neuronal function. Its pharmacological profile suggests a role in treating conditions related to poor blood circulation and cognitive decline. Additionally, Breviscapine is generally well-tolerated, with a favorable safety profile, although specific side effects may vary among individuals. As research continues, the full spectrum of its therapeutic potential and mechanisms of action is being explored, contributing to its growing interest in both traditional and modern medicine.
Formula:Unspecified
InChI:InChI=1/C21H18O12/c22-8-3-1-7(2-4-8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-22,24-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1
- Synonyms:
- 4H-1-benzopyran-4-one, 7-(beta-D-glucopyranuronosyloxy)-5,6-dihydroxy-2-(4-hydroxyphenyl)-
- 5,6-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranosiduronic acid
- Breviscapine
- Breviscapinun
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Breviscapine REF: IN-DA000BOOCAS: 116122-36-2 | 80% | 38.00 €~163.00 € | Tue 01 Apr 25 |
![]() | Breviscapin REF: TM-T3242CAS: 116122-36-2 | 98.21% | 49.00 €~56.00 € | Tue 08 Apr 25 |

Ref: IN-DA000BOO
1g | 38.00 € | ||
5g | 67.00 € | ||
25g | 150.00 € |

Breviscapin
Ref: TM-T3242
50mg | 49.00 € | ||
100mg | 56.00 € |