CAS 116129-08-9: 1,3-Cyclobutanedicarboxylic acid, 1-amino-, hydrochloride, cis-

Description:1,3-Cyclobutanedicarboxylic acid, 1-amino-, hydrochloride, cis- is a chemical compound characterized by its cyclic structure and the presence of both carboxylic acid and amino functional groups. The compound features a cyclobutane ring with two carboxylic acid groups located at the 1 and 3 positions, contributing to its dicarboxylic acid nature. The amino group is positioned at the 1-position, and the compound exists in its hydrochloride form, indicating the presence of a chloride ion associated with the amino group. This hydrochloride form enhances the solubility of the compound in water, making it more accessible for various applications. The cis- configuration refers to the spatial arrangement of the substituents on the cyclobutane ring, which can influence the compound's reactivity and interactions. Such compounds are often studied for their potential biological activities and applications in pharmaceuticals, as the presence of both carboxylic and amino groups can facilitate interactions with biological systems.

Formula:C₆H₉NO₄·ClH

InChI:InChI=1/C6H9NO4.ClH/c7-6(5(10)11)1-3(2-6)4(8)9;/h3H,1-2,7H2,(H,8,9)(H,10,11);1H/t3-,6+;

InChI key:InChIKey=VUKJBSWMLAPJGZ-FWRXRQRWNA-N

SMILES:Cl.O=C(O)C1CC(N)(C(=O)O)C1