CAS 1162257-54-6: B-[3-(1,1-Difluoroethyl)phenyl]boronic acid

Description:B-[3-(1,1-Difluoroethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a 1,1-difluoroethyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible complexes with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The difluoroethyl substituent can influence the compound's reactivity and solubility, potentially enhancing its stability and selectivity in chemical reactions. Additionally, boronic acids are known for their role in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The presence of fluorine atoms may also impart unique electronic properties, affecting the compound's interaction with biological targets or its behavior in different solvents. Overall, B-[3-(1,1-Difluoroethyl)phenyl]boronic acid represents a versatile building block in the synthesis of complex organic molecules.

Formula:C₈H₉BF₂O₂

InChI:InChI=1S/C8H9BF2O2/c1-8(10,11)6-3-2-4-7(5-6)9(12)13/h2-5,12-13H,1H3

InChI key:InChIKey=UNBMWVIFKWQQIA-UHFFFAOYSA-N

SMILES:FC(F)(C=1C=CC=C(C1)B(O)O)C