CAS 116247-99-5: 1-(2-Pyrazinyl)-4-piperidinone

Description:1-(2-Pyrazinyl)-4-piperidinone is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a piperidinone moiety. This compound typically exhibits properties associated with both heterocyclic and cyclic amine compounds, making it of interest in medicinal chemistry and drug development. It is often studied for its potential biological activities, including antimicrobial and antitumor properties. The presence of the pyrazine ring contributes to its electron-withdrawing characteristics, which can influence its reactivity and interaction with biological targets. Additionally, the piperidinone structure may enhance its solubility and stability in various solvents. The compound's molecular formula and weight, along with its specific functional groups, play a crucial role in determining its chemical behavior and potential applications. As with many heterocyclic compounds, the synthesis and characterization of 1-(2-Pyrazinyl)-4-piperidinone are essential for understanding its properties and exploring its utility in pharmaceutical research.

Formula:C₉H₁₁N₃O

InChI:InChI=1S/C9H11N3O/c13-8-1-5-12(6-2-8)9-7-10-3-4-11-9/h3-4,7H,1-2,5-6H2

InChI key:InChIKey=XPCSQADQDLPZMM-UHFFFAOYSA-N

SMILES:O=C1CCN(C2=NC=CN=C2)CC1