CAS 1171918-94-7
:4,6-Dichloro-8-iodoquinoline
Description:
4,6-Dichloro-8-iodoquinoline is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features two chlorine atoms and one iodine atom substituted at the 4, 6, and 8 positions of the quinoline ring, respectively. The presence of these halogen substituents significantly influences its chemical properties, including its reactivity and potential biological activity. 4,6-Dichloro-8-iodoquinoline is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its halogenated nature suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated compounds often display enhanced biological activity. Additionally, the compound may be of interest in materials science and organic synthesis due to its unique structural features. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4,6-Dichloro-8-iodoquinoline is a notable compound within the realm of organic chemistry and medicinal research.
Formula:C9H4Cl2IN
InChI:InChI=1S/C9H4Cl2IN/c10-5-3-6-7(11)1-2-13-9(6)8(12)4-5/h1-4H
InChI key:InChIKey=FKOSDCAERUFQBB-UHFFFAOYSA-N
SMILES:IC=1C2=C(C=C(Cl)C1)C(Cl)=CC=N2
Synonyms:- 4,6-Dichloro-8-iodoquinoline
- Quinoline, 4,6-dichloro-8-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.