CAS 117880-10-1
:N,N-dimethyl-13C2-formamide
Description:
N,N-Dimethyl-13C2-formamide is a labeled isotopologue of dimethylformamide, where the carbon atoms in the formamide group are isotopically enriched with carbon-13. This compound is characterized by its molecular formula, which includes two methyl groups attached to a formamide functional group. It is a colorless liquid with a characteristic amine-like odor and is miscible with water and many organic solvents. The presence of the carbon-13 isotope allows for its use in various analytical techniques, such as nuclear magnetic resonance (NMR) spectroscopy, where it can serve as a tracer or a solvent in studies involving carbon labeling. N,N-Dimethyl-13C2-formamide is often utilized in organic synthesis and as a solvent in chemical reactions due to its ability to dissolve a wide range of polar and nonpolar compounds. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may pose health risks upon exposure.
Formula:C3H7NO
InChI:InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1+1,2+1
Synonyms:- N,N-di(methyl)formamide
- 13C Labeled N,N,-dimethylformamide
- N,N-DIMETHYL-13C2-FORMAMIDE, 99 ATOM % 1 3C
- N,N-DIMETHYL-13C2-FORMAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.