CymitQuimica logo

CAS 1185304-51-1

:

Benzenamine, 4-(2-methoxyethoxy)-3-methyl-, hydrochloride (1:1)

Description:
Benzenamine, 4-(2-methoxyethoxy)-3-methyl-, hydrochloride (1:1) is an organic compound characterized by its amine functional group and aromatic structure. It features a benzene ring substituted with a methoxyethoxy group and a methyl group, which contributes to its unique chemical properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions in various chemical environments. The presence of the methoxyethoxy group suggests potential applications in pharmaceuticals or as a building block in organic synthesis, given its ability to participate in nucleophilic reactions. Additionally, the compound's molecular structure may impart specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H15NO2·ClH
InChI:InChI=1S/C10H15NO2.ClH/c1-8-7-9(11)3-4-10(8)13-6-5-12-2;/h3-4,7H,5-6,11H2,1-2H3;1H
InChI key:InChIKey=LPSKYLSPRSOPPP-UHFFFAOYSA-N
SMILES:O(CCOC)C1=C(C)C=C(N)C=C1.Cl
Synonyms:
  • Benzenamine, 4-(2-methoxyethoxy)-3-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.