CAS 118623-71-5

2-hydroxy-N-(pyridin-3-yl)benzamide

Description:

2-Hydroxy-N-(pyridin-3-yl)benzamide, with the CAS number 118623-71-5, is an organic compound characterized by its functional groups, including a hydroxyl group (-OH) and an amide group (-C(=O)N-). This compound features a benzamide structure where a pyridine ring is substituted at the nitrogen with a hydroxyl group on the benzene ring. The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may influence its reactivity and hydrogen bonding capabilities. The pyridine moiety can impart basicity and participate in various interactions, making this compound of interest in medicinal chemistry and material science. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with biological activity. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for further characterization and application in research and industry.

Formula: C₁₂H₁₀N₂O₂

InChI: InChI=1/C12H10N2O2/c15-11-6-2-1-5-10(11)12(16)14-9-4-3-7-13-8-9/h1-8,15H,(H,14,16)

SMILES: c1ccc(c(c1)C(=Nc1cccnc1)O)O

Synonyms:

• benzamide, 2-hydroxy-N-3-pyridinyl-
• 2-hydroxy-N-(3-pyridinyl)benzamide

2-Hydroxy-N-pyridin-3-ylbenzamide

Controlled Product

CAS: 118623-71-5

Applications 2-hydroxy-N-pyridin-3-ylbenzamide (cas# 118623-71-5) is a useful research chemical.

Formula: C₁₂H₁₀N₂O₂

Color and Shape: Neat

Molecular weight: 214.22

Ref: TR-H953940