CAS 1187927-24-7

4-Piperidinone, 1-(4-aminobenzoyl)-, hydrochloride (1:1)

Description:

4-Piperidinone, 1-(4-aminobenzoyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidinone core structure, which is a six-membered ring containing a nitrogen atom and a carbonyl group. The compound features a 4-aminobenzoyl substituent, indicating the presence of an amino group attached to a benzoyl moiety, which contributes to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having implications in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions of use and the presence of other functional groups. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₂H₁₄N₂O₂·ClH

InChI: InChI=1S/C12H14N2O2.ClH/c13-10-3-1-9(2-4-10)12(16)14-7-5-11(15)6-8-14;/h1-4H,5-8,13H2;1H

InChI key: InChIKey=PJMDQYJMZFPWGF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(N)C=C1)N2CCC(=O)CC2.Cl

Synonyms:

• 4-Piperidinone, 1-(4-aminobenzoyl)-, hydrochloride (1:1)

1-(4-Aminobenzoyl)piperidin-4-one hydrochloride

CAS: 1187927-24-7

Formula: C₁₂H₁₅ClN₂O₂

Molecular weight: 254.7127

Ref: IN-DA008XA2

4-(4-Oxo-piperidine-1-carbonyl)aniline hydrochloride

Controlled Product

CAS: 1187927-24-7

Please enquire for more information about 4-(4-Oxo-piperidine-1-carbonyl)aniline hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₁₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 254.71 g/mol

Ref: 3D-MXB92724