CymitQuimica logo

CAS 119489-67-7

:

3-(HEPTADECAFLUOROOCTYL)ANILINE

Description:
3-(Heptadecafluorooctyl)aniline, with the CAS number 119489-67-7, is a fluorinated organic compound characterized by the presence of a long perfluorinated alkyl chain attached to an aniline moiety. This compound features a heptadecafluorooctyl group, which consists of a chain of carbon atoms fully substituted with fluorine atoms, imparting unique properties such as hydrophobicity and lipophobicity. The aniline part of the molecule contributes to its potential as a building block in various chemical applications, including surfactants, coatings, and polymer additives. The fluorinated alkyl chain enhances the compound's thermal stability and chemical resistance, making it suitable for use in harsh environments. Additionally, the presence of the amino group in the aniline structure allows for potential reactivity and interaction with other chemical species, which can be exploited in synthesis or functionalization processes. Overall, this compound exemplifies the characteristics of fluorinated compounds, including low surface energy and high resistance to degradation, which are valuable in many industrial applications.
Formula:C14H6F17N
InChI:InChI=1/C14H6F17N/c15-7(16,5-2-1-3-6(32)4-5)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h1-4H,32H2
SMILES:c1cc(cc(c1)N)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.