CymitQuimica logo

CAS 1204296-80-9

:

4-[[(Dimethylamino)carbonyl]oxy]benzoic acid

Description:
4-[[(Dimethylamino)carbonyl]oxy]benzoic acid, also known by its CAS number 1204296-80-9, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a dimethylamino carbonyl group. This compound features a carboxylic acid functional group (-COOH) that imparts acidic properties, while the dimethylamino group contributes to its basicity and potential for forming salts. The presence of the carbonyl and ether functionalities suggests that it may participate in various chemical reactions, including esterification and amidation. Its structure indicates potential applications in pharmaceuticals, particularly as a building block in drug synthesis or as an intermediate in organic reactions. The compound's solubility and reactivity can be influenced by the pH of the environment, making it relevant in biochemical contexts. Additionally, the dimethylamino group may enhance its ability to interact with biological targets, potentially affecting its pharmacological profile. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical and biological systems.
Formula:C10H11NO4
InChI:InChI=1S/C10H11NO4/c1-11(2)10(14)15-8-5-3-7(4-6-8)9(12)13/h3-6H,1-2H3,(H,12,13)
InChI key:InChIKey=HWLJNIMQTJLYGZ-UHFFFAOYSA-N
SMILES:O(C(N(C)C)=O)C1=CC=C(C(O)=O)C=C1
Synonyms:
  • Benzoic acid, 4-[[(dimethylamino)carbonyl]oxy]-
  • 4-[[(Dimethylamino)carbonyl]oxy]benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.