CAS 1204810-31-0: 3-Bromo-4-chloro-7-fluoroquinoline
Description:3-Bromo-4-chloro-7-fluoroquinoline is a heterocyclic organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. This compound features three halogen substituents: bromine at the 3-position, chlorine at the 4-position, and fluorine at the 7-position, which significantly influence its chemical reactivity and physical properties. The presence of these halogens can enhance the compound's biological activity, making it of interest in medicinal chemistry, particularly in the development of antimicrobial or anticancer agents. The molecular structure contributes to its potential interactions with biological targets, and the halogen atoms can affect solubility, stability, and lipophilicity. Additionally, 3-Bromo-4-chloro-7-fluoroquinoline may exhibit fluorescence properties, which can be useful in various analytical applications. Its synthesis typically involves halogenation reactions on a quinoline precursor, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity.
Formula:C9H4BrClFN
InChI:InChI=1S/C9H4BrClFN/c10-7-4-13-8-3-5(12)1-2-6(8)9(7)11/h1-4H
InChI key:InChIKey=LXUBHOHQRPBQPB-UHFFFAOYSA-N
SMILES:FC=1C=CC=2C(=NC=C(Br)C2Cl)C1
- Synonyms:
- 3-Bromo-4-chloro-7-fluoroquinoline
- Quinoline, 3-bromo-4-chloro-7-fluoro-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Bromo-4-chloro-7-fluoroquinoline REF: IN-DA00935PCAS: 1204810-31-0 | - - - | To inquire | Mon 03 Mar 25 |
 | 3-Bromo-4-chloro-7-fluoroquinoline REF: 54-PC404596CAS: 1204810-31-0 | - - - | 514.00 € | Mon 10 Mar 25 |
 | 3-Bromo-4-chloro-7-fluoroquinoline REF: TR-B874593CAS: 1204810-31-0 | - - - | 111.00 €~513.00 € | Tue 15 Apr 25 |
 | 3-Bromo-4-chloro-7-fluoroquinoline REF: 10-F756233CAS: 1204810-31-0 | 97% | - - - | Discontinued product |
 | 3-Bromo-4-chloro-7-fluoroquinoline REF: 3D-EYB81031CAS: 1204810-31-0 | Min. 95% | - - - | Discontinued product |
3-Bromo-4-chloro-7-fluoroquinoline
Ref: IN-DA00935P
| Undefined size | To inquire |
3-Bromo-4-chloro-7-fluoroquinoline
Controlled ProductRef: TR-B874593
| 50mg | 111.00 € | ||
| 100mg | 155.00 € | ||
| 500mg | 513.00 € |
Ref: 10-F756233
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
3-Bromo-4-chloro-7-fluoroquinoline
Ref: 3D-EYB81031
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
