CAS 1220027-37-1

1-Piperazineethanol, 4-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)

Description:

1-Piperazineethanol, 4-(2-pyrrolidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and pyrrolidine moieties, which contribute to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of both piperazine and pyrrolidine rings suggests that this compound may exhibit properties relevant to central nervous system activity, possibly acting as a neurotransmitter modulator or having anxiolytic effects. Its structure allows for the formation of hydrogen bonds, which can influence its interaction with biological targets. Additionally, the compound's hydrochloride form indicates that it is likely to be stable under standard conditions, making it suitable for laboratory and industrial use. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with potential pharmacological effects. Further research is necessary to fully elucidate its properties and potential applications in medicinal chemistry.

Formula: C₁₁H₂₃N₃O·2ClH

InChI: InChI=1S/C11H23N3O.2ClH/c15-9-8-13-4-6-14(7-5-13)10-11-2-1-3-12-11;;/h11-12,15H,1-10H2;2*1H

InChI key: InChIKey=GHGJNEAVYFREOY-UHFFFAOYSA-N

SMILES: C(N1CCN(CCO)CC1)C2CCCN2.Cl

Synonyms:

• 1-Piperazineethanol, 4-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)