CAS 1228183-22-9: 1H-benzo[d]imidazol-5-ylboronicacid
Description:1H-Benzo[d]imidazol-5-ylboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a benzo[d]imidazole ring system. This compound typically exhibits properties associated with both boronic acids and heterocyclic aromatic compounds. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including drug development and organic synthesis. The benzo[d]imidazole moiety contributes to the compound's potential biological activity, as many derivatives of this structure are known to exhibit pharmacological properties. In terms of solubility, boronic acids often show good solubility in polar solvents, which can facilitate their use in various chemical reactions. Additionally, the compound may participate in coordination chemistry due to the presence of the boron atom, allowing it to interact with metal ions. Overall, 1H-Benzo[d]imidazol-5-ylboronic acid is a versatile compound with significant implications in medicinal chemistry and materials science.
Formula:C7H7BN2O2
InChI:InChI=1S/C7H7BN2O2/c11-8(12)5-1-2-6-7(3-5)10-4-9-6/h1-4,11-12H,(H,9,10)

Boronic acid, B-1H-benzimidazol-6-yl-
Ref: IN-DA000JJE
1g | 330.00 € | ||
5g | To inquire | ||
100mg | 102.00 € | ||
250mg | 171.00 € |

(1H-Benzo[d]imidazol-5-yl)boronic acid
Ref: 10-F209304
1g | 333.00 € | ||
5g | 1,116.00 € | ||
100mg | 91.00 € | ||
250mg | 156.00 € |

1H-Benzo[d]imidazol-6-ylboronic acid
Ref: 3D-FH160014
100mg | 348.00 € | ||
250mg | 475.00 € | ||
500mg | 676.00 € |