CAS 1228666-47-4
:2-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-6-fluoropyridine
Description:
2-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-6-fluoropyridine, with the CAS number 1228666-47-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridine ring substituted with a fluorine atom and a pyrrolidine moiety. The presence of a dimethylsilyl group indicates that it has potential applications in organosilicon chemistry, enhancing its stability and solubility in various solvents. The tert-butyl group contributes to steric hindrance, which may influence the compound's reactivity and interaction with biological targets. This compound is likely to exhibit unique pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a class of molecules that may have significant implications in drug design and development.
Formula:C16H27FN2OSi
InChI:InChI=1S/C16H27FN2OSi/c1-16(2,3)21(4,5)20-12-13-9-10-19(11-13)15-8-6-7-14(17)18-15/h6-8,13H,9-12H2,1-5H3
InChI key:InChIKey=OBODMQKCOATHFD-UHFFFAOYSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)C1CN(CC1)C=2N=C(F)C=CC2
Synonyms:- Pyridine, 2-[3-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-6-fluoro-
- 2-[3-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-1-pyrrolidinyl]-6-fluoropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.