CAS 1260386-48-8

Methyl 4-chloro-2-methyl-1H-indole-6-carboxylate

Description:

Methyl 4-chloro-2-methyl-1H-indole-6-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a methyl group and a chloro substituent at specific positions on the indole ring, contributing to its unique reactivity and properties. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification or nucleophilic substitutions. Methyl 4-chloro-2-methyl-1H-indole-6-carboxylate is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its solubility, stability, and reactivity can vary depending on the solvent and conditions used in reactions. As with many indole derivatives, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health and environmental risks.

Formula: C₁₁H₁₀ClNO₂

InChI: InChI=1S/C11H10ClNO2/c1-6-3-8-9(12)4-7(11(14)15-2)5-10(8)13-6/h3-5,13H,1-2H3

InChI key: InChIKey=HCJYOILHUUAOQD-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(C(OC)=O)=C1)NC(C)=C2

Synonyms:

• Methyl 4-chloro-2-methyl-1H-indole-6-carboxylate
• 1H-Indole-6-carboxylic acid, 4-chloro-2-methyl-, methyl ester