CAS 1261894-05-6
:3-(1,3-Benzodioxol-5-yl)-5-nitrobenzoic acid
Description:
3-(1,3-Benzodioxol-5-yl)-5-nitrobenzoic acid, identified by its CAS number 1261894-05-6, is an organic compound characterized by its complex aromatic structure. This substance features a benzodioxole moiety, which contributes to its unique chemical properties, including potential electron-donating characteristics due to the presence of the dioxole ring. The nitro group at the 5-position of the benzoic acid enhances its reactivity, making it a candidate for various chemical reactions, including electrophilic substitution. The carboxylic acid functional group imparts acidic properties, allowing it to participate in acid-base reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in synthesis and biological assays. Overall, 3-(1,3-Benzodioxol-5-yl)-5-nitrobenzoic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C14H9NO6
InChI:InChI=1S/C14H9NO6/c16-14(17)10-3-9(4-11(5-10)15(18)19)8-1-2-12-13(6-8)21-7-20-12/h1-6H,7H2,(H,16,17)
InChI key:InChIKey=UXOUCOQRLOAZHY-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(N(=O)=O)C1)C=2C=C3C(=CC2)OCO3
Synonyms:- 3-(1,3-Benzodioxol-5-yl)-5-nitrobenzoic acid
- Benzoic acid, 3-(1,3-benzodioxol-5-yl)-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
