CAS 1269294-25-8

Ethyl 6-amino-2-(trifluoromethyl)-4-pyrimidinecarboxylate

Description:

Ethyl 6-amino-2-(trifluoromethyl)-4-pyrimidinecarboxylate is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of an amino group at the 6-position and a trifluoromethyl group at the 2-position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The ethyl ester functional group at the carboxylate position enhances its ability to participate in various chemical reactions, such as esterification and nucleophilic substitution. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its trifluoromethyl group can also influence lipophilicity and metabolic stability, which are critical factors in drug design. Overall, Ethyl 6-amino-2-(trifluoromethyl)-4-pyrimidinecarboxylate is a versatile compound with potential applications in medicinal chemistry and related fields.

Formula: C₈H₈F₃N₃O₂

InChI: InChI=1S/C8H8F3N3O2/c1-2-16-6(15)4-3-5(12)14-7(13-4)8(9,10)11/h3H,2H2,1H3,(H2,12,13,14)

InChI key: InChIKey=SQQJVHUEUVBXAJ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=NC(C(F)(F)F)=NC(N)=C1

Synonyms:

• 4-Pyrimidinecarboxylic acid, 6-amino-2-(trifluoromethyl)-, ethyl ester
• Ethyl 6-amino-2-(trifluoromethyl)-4-pyrimidinecarboxylate