CymitQuimica logo

CAS 1280787-24-7

:

α-Fluoro-4-methoxy-β-oxobenzenepropanenitrile

Description:
α-Fluoro-4-methoxy-β-oxobenzenepropanenitrile is a chemical compound characterized by its unique functional groups and structural features. It contains a fluorine atom, which can influence its reactivity and polarity, making it potentially useful in various synthetic applications. The presence of a methoxy group contributes to its electron-donating properties, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. The β-oxobenzenepropanenitrile moiety indicates that the compound has both a ketone and a nitrile functional group, which can participate in nucleophilic addition reactions and contribute to its overall chemical behavior. This compound may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its specific properties, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, α-Fluoro-4-methoxy-β-oxobenzenepropanenitrile represents a complex structure with potential applications in organic synthesis and medicinal chemistry.
Formula:C10H8FNO2
InChI:InChI=1S/C10H8FNO2/c1-14-8-4-2-7(3-5-8)10(13)9(11)6-12/h2-5,9H,1H3
InChI key:InChIKey=VOQAUBMZINIKIQ-UHFFFAOYSA-N
SMILES:C(C(C#N)F)(=O)C1=CC=C(OC)C=C1
Synonyms:
  • α-Fluoro-4-methoxy-β-oxobenzenepropanenitrile
  • Benzenepropanenitrile, α-fluoro-4-methoxy-β-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.