
CAS 1315366-99-4
:N1-[2,2,2-Trifluoro-1-(tetrahydro-2-furanyl)ethyl]-1,2-ethanediamine
Description:
N1-[2,2,2-Trifluoro-1-(tetrahydro-2-furanyl)ethyl]-1,2-ethanediamine is a chemical compound characterized by its unique structure, which includes a trifluoromethyl group and a tetrahydrofuran moiety. This compound features two amine groups, making it a diamine, which can participate in various chemical reactions, including those involving nucleophilic substitution and hydrogen bonding. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, potentially making it useful in pharmaceutical applications. The tetrahydrofuran ring contributes to the compound's cyclic structure, which can affect its conformational flexibility and reactivity. Additionally, the compound's molecular weight and specific functional groups suggest potential solubility in organic solvents. Overall, this compound's distinctive features make it of interest in both synthetic chemistry and medicinal chemistry, where its properties can be exploited for developing new therapeutic agents or materials.
Formula:C8H15F3N2O
InChI:InChI=1S/C8H15F3N2O/c9-8(10,11)7(13-4-3-12)6-2-1-5-14-6/h6-7,13H,1-5,12H2
InChI key:InChIKey=ALEQPWLRXBDCMJ-UHFFFAOYSA-N
SMILES:C(NCCN)(C(F)(F)F)C1CCCO1
Synonyms:- 1,2-Ethanediamine, N1-[2,2,2-trifluoro-1-(tetrahydro-2-furanyl)ethyl]-
- N1-[2,2,2-Trifluoro-1-(tetrahydro-2-furanyl)ethyl]-1,2-ethanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.