CAS 13228-40-5: 2-PYRIDIN-2-YL-1H-INDOLE

Description:2-Pyridin-2-yl-1H-indole, with the CAS number 13228-40-5, is a heterocyclic organic compound that features a pyridine ring fused to an indole structure. This compound exhibits characteristics typical of both pyridine and indole derivatives, including potential aromaticity and basicity due to the nitrogen atom in the pyridine ring. It is generally characterized by its ability to participate in various chemical reactions, such as electrophilic substitutions and coordination with metal ions, owing to the presence of nitrogen atoms. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility can vary depending on the solvent, and it may display fluorescence properties, which can be useful in analytical applications. Additionally, the presence of both aromatic systems can contribute to its stability and reactivity, influencing its interactions in biological systems or synthetic pathways. Overall, 2-pyridin-2-yl-1H-indole is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.

Formula:C₁₃H₁₀N₂

InChI:InChI=1/C13H10N2/c1-2-6-11-10(5-1)9-13(15-11)12-7-3-4-8-14-12/h1-9,15H

Synonyms:
2-(2-Pyridinyl)-1H-Indole

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2-(2-Pyridyl)indole REF: 3B-P2142CAS: 13228-40-5	>97.0%(GC)	117.00 €	Tue 22 Apr 25
1H-Indole, 2-(2-pyridinyl)- REF: IN-DA0010HJCAS: 13228-40-5	98%	43.00 €~538.00 €	Tue 29 Apr 25
2-(Pyridin-2-yl)-1H-indole REF: 54-OR01564CAS: 13228-40-5	98+%	32.00 €~2,680.00 €	Mon 28 Apr 25
2-(2-Pyridinyl)-1H-indole REF: 10-F230677CAS: 13228-40-5	95.0%	To inquire	Wed 07 May 25
2-(2-Pyridyl)indole REF: 3D-NAA22840CAS: 13228-40-5	Min. 95%	- - -	Discontinued product