CAS 1346604-88-3

2-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione

Description:

The chemical substance known as 2-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione, with the CAS number 1346604-88-3, is a complex organic compound characterized by its unique structural features. It contains a benzoxazine ring fused with a tetrahydroisoindole moiety, which contributes to its potential biological activity. The presence of a fluorine atom and a prop-2-ynyl group suggests that it may exhibit interesting electronic properties and reactivity. This compound is likely to be of interest in medicinal chemistry due to its potential pharmacological applications, possibly acting as an inhibitor or modulator in various biological pathways. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its stability, solubility, and reactivity would be influenced by the functional groups present. Further studies would be necessary to elucidate its specific properties, including its biological activity, mechanism of action, and potential therapeutic uses.

Formula: C₁₉H₁₅FN₂O₄

InChI: InChI=1S/C19H15FN2O4/c1-2-7-21-15-9-14(13(20)8-16(15)26-10-17(21)23)22-18(24)11-5-3-4-6-12(11)19(22)25/h1,8-9H,3-7,10H2/i1+1,2+1,7+1

InChI key: InChIKey=FOUWCSDKDDHKQP-BTCZPRMESA-N

SMILES: O=C1N(C(=O)C2=C1CCCC2)C=3C=C4N([13CH2][13C]#[13CH])C(=O)COC4=CC3F

Synonyms:

• 2-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione

Flumioxazin-13C3

Controlled Product

CAS: 1346604-88-3

Applications Labelled Flumioxazin (F500470). Herbicide.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Walker, L., et al.: J. Environ. Horticulture, 28, 8 (2010), Meyers, S., et al.: Weed Technol., 24, 495 (2010),

Formula: C₃C₁₆H₁₅FN₂O₄

Color and Shape: Neat

Molecular weight: 357.31

Ref: TR-F500472