CAS 13487-42-8
:cis-7,10,13,16-docosatetraenoic acid*methyl ester
Description:
Cis-7,10,13,16-docosatetraenoic acid methyl ester, also known as methyl cis-7,10,13,16-docosatetraenoate, is a methyl ester derived from a polyunsaturated fatty acid. This compound features a long carbon chain with four double bonds located at specific positions, which contributes to its unsaturated nature. The "cis" configuration indicates that the hydrogen atoms adjacent to the double bonds are on the same side, influencing its physical properties and biological activity. Typically, such methyl esters are oily liquids at room temperature, exhibiting low viscosity and a relatively low melting point compared to saturated fatty acids. They are soluble in organic solvents but have limited solubility in water. This compound is of interest in various fields, including biochemistry and nutrition, due to its potential role in human health and its applications in the synthesis of bioactive lipids. Additionally, it may be involved in studies related to fatty acid metabolism and the development of functional foods or nutraceuticals.
Formula:C23H38O2
InChI:InChI=1/C23H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-2/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-22H2,1-2H3/b8-7-,11-10-,14-13-,17-16-
SMILES:CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cis-7,10,13,16,19-Docosa-tetraenoic acid methyl ester
CAS:Formula:C23H38O2Purity:98%Molecular weight:346.5466Methyl 7(Z),10(Z),13(Z),16(Z)-Docosatetraenoate
CAS:Formula:C23H38O2Purity:>99%Color and Shape:LiquidMolecular weight:346.55cis-7,10,13,16-Docosatetraenoic Acid Methyl Ester
CAS:Controlled ProductFormula:C23H38O2Color and Shape:NeatMolecular weight:346.547cis-7,10,13,16-Docosatetraenoic Acid Methyl Ester-d3
CAS:Controlled Product<p>Applications cis-7,10,13,16-Docosatetraenoic Acid Methyl Ester-d3 is a labelled analog of cis-7,10,13,16-Docosatetraenoic Acid Methyl Ester. cis-7,10,13,16-Docosatetraenoic Acid Methyl Ester is used in oregano essential oil as an inhibitor of higher fatty acid oxidation.<br>References Terenina, M.B., et al.: Appl. Biochem. Microbiol., 47, 445 (2011)<br></p>Formula:C23D3H35O2Color and Shape:NeatMolecular weight:349.565



