
CAS 13980-04-6
:Hexahydro-1,3,5-trinitroso-1,3,5-triazine
Description:
Hexahydro-1,3,5-trinitroso-1,3,5-triazine, commonly known as RDX (Research Department Explosive), is a powerful explosive compound characterized by its high stability and insensitivity to shock, making it safer to handle compared to other explosives. It is a cyclic compound with a triazine ring structure, featuring three nitro groups that contribute to its explosive properties. RDX is typically white crystalline in appearance and is soluble in organic solvents but has low solubility in water. Its molecular structure allows for rapid decomposition under detonation, releasing a significant amount of energy. RDX is widely used in military applications, including as a component in various munitions and as a booster for other explosives. Additionally, it has been studied for its potential environmental impact due to its persistence in soil and water, leading to concerns about contamination. Overall, RDX is notable for its effectiveness as an explosive while also presenting challenges related to safety and environmental management.
Formula:C3H6N6O3
InChI:InChI=1S/C3H6N6O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1-3H2
InChI key:InChIKey=HFWOSHMLDRSIDN-UHFFFAOYSA-N
SMILES:N(=O)N1CN(N=O)CN(N=O)C1
Synonyms:- Trinitrosotrimethylenetriamine
- 1,3,5-Trinitroso-1,3,5-triazacyclohexane
- 1,3,5-Triazine, hexahydro-1,3,5-trinitroso-
- s-Triazine, hexahydro-1,3,5-trinitroso-
- Hexahydro-1,3,5-trinitroso-1,3,5-triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

