CAS 14080-55-8

THIENO[2,3-D]PYRIMIDINE-4-THIOL

Description:

Thieno[2,3-d]pyrimidine-4-thiol is a heterocyclic compound characterized by a fused ring system that includes both a thieno and a pyrimidine moiety. This compound features a thiol (-SH) functional group at the 4-position of the pyrimidine ring, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of sulfur in the thieno ring enhances its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and metal coordination. Thieno[2,3-d]pyrimidine-4-thiol is of interest in the development of pharmaceuticals due to its potential biological activities, including antimicrobial and anticancer properties. Its structural features allow for interactions with biological targets, which can be explored in drug design. Additionally, the compound may exhibit solubility in organic solvents, influencing its behavior in different chemical environments. Overall, thieno[2,3-d]pyrimidine-4-thiol represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₆H₄N₂OS

InChI: InChI=1/C6H4N2OS/c9-6-5-4(1-2-10-5)7-3-8-6/h1-3H,(H,7,8,9)

SMILES: c1csc2c1ncnc2O

Synonyms:

• Thieno[2,3-D]Pyrimidine-4-Thiolate
• thieno[3,2-d]pyrimidin-4(1H)-one
• Thieno[3,2-D]Pyrimidin-4-Ol

Thieno[3,2-d]pyrimidin-4-ol

CAS: 14080-55-8

Formula: C₆H₄N₂S₂

Molecular weight: 168.2394

Ref: IN-DA001CSQ

Thieno[3,2-d]pyrimidin-4-ol

CAS: 14080-55-8

Thieno[3,2-d]pyrimidin-4-ol

Purity: 95%

Molecular weight: 152.17g/mol

Ref: 54-OR952006

Thieno[2,3-d]pyrimidine-4-thiol

CAS: 14080-55-8

Formula: C₆H₄N₂S₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 168.23

Ref: 10-F042392

Thieno[2,3-d]pyrimidine-4-thiol

CAS: 14080-55-8

Versatile small molecule scaffold

Formula: C₆H₄N₂S₂

Purity: Min. 95%

Molecular weight: 168.2 g/mol

Ref: 3D-PAA08055