CymitQuimica logo

CAS 1415719-09-3

:

1-(4-Acetylphenyl)-3-[(cyclopropylmethyl)amino]-2,5-pyrrolidinedione

Description:
1-(4-Acetylphenyl)-3-[(cyclopropylmethyl)amino]-2,5-pyrrolidinedione, identified by its CAS number 1415719-09-3, is a synthetic organic compound characterized by its unique molecular structure, which includes a pyrrolidine ring and various functional groups. The presence of an acetylphenyl moiety suggests potential aromatic interactions, while the cyclopropylmethylamino group may impart specific steric and electronic properties. This compound is likely to exhibit properties typical of pyrrolidine derivatives, such as potential biological activity, which could include analgesic or anti-inflammatory effects, although specific pharmacological data may vary. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular conformation. As with many synthetic compounds, safety and handling precautions are essential, and its use in research or pharmaceutical applications would require thorough evaluation of its toxicological profile. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C16H18N2O3
InChI:InChI=1S/C16H18N2O3/c1-10(19)12-4-6-13(7-5-12)18-15(20)8-14(16(18)21)17-9-11-2-3-11/h4-7,11,14,17H,2-3,8-9H2,1H3
InChI key:InChIKey=KIWCQZOUIROYBM-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)CC1NCC2CC2)C3=CC=C(C(C)=O)C=C3
Synonyms:
  • 1-(4-Acetylphenyl)-3-[(cyclopropylmethyl)amino]-2,5-pyrrolidinedione
  • 2,5-Pyrrolidinedione, 1-(4-acetylphenyl)-3-[(cyclopropylmethyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.