CAS 1423029-40-6

Benzenepropanamide, β-amino-N-[1-(5-chloro-2-thienyl)ethyl]-, hydrochloride (1:1)

Description:

Benzenepropanamide, β-amino-N-[1-(5-chloro-2-thienyl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a thienyl moiety, which contributes to its unique properties. The presence of the β-amino group indicates that it has an amino group attached to the β-carbon of the propanamide structure, which can influence its biological activity and solubility. The hydrochloride form suggests that the compound is a salt, enhancing its stability and solubility in aqueous solutions, making it suitable for pharmaceutical applications. The 5-chloro-2-thienyl group introduces halogen substitution, which can affect the compound's reactivity and interaction with biological targets. Overall, this compound may exhibit specific pharmacological properties, potentially making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its precise characteristics, including melting point, solubility, and biological activity, would require further investigation through experimental studies.

Formula: C₁₅H₁₇ClN₂OS·ClH

InChI: InChI=1S/C15H17ClN2OS.ClH/c1-10(13-7-8-14(16)20-13)18-15(19)9-12(17)11-5-3-2-4-6-11;/h2-8,10,12H,9,17H2,1H3,(H,18,19);1H

InChI key: InChIKey=WITYRFFBMOOMSU-UHFFFAOYSA-N

SMILES: C(NC(CC(N)C1=CC=CC=C1)=O)(C)C2=CC=C(Cl)S2.Cl

Synonyms:

• Benzenepropanamide, β-amino-N-[1-(5-chloro-2-thienyl)ethyl]-, hydrochloride (1:1)